About N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine
N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine (PubChem CID 87337521) has the molecular formula C11H9Cl3N4
and a molecular weight of 303.58 g/mol. Its IUPAC name is N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine |
| PubChem CID | 87337521 |
| Molecular Formula | C11H9Cl3N4 |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine |
| SMILES | CN(C)c1ccnc(-c2nc(Cl)c(Cl)c(Cl)n2)c1 |
| InChI | InChI=1S/C11H9Cl3N4/c1-18(2)6-3-4-15-7(5-6)11-16-9(13)8(12)10(14)17-11/h3-5H,1-2H3 |
| InChIKey | AUAFZPLIMAQMJJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine?
The IUPAC name of N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine (CID 87337521) is N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine.
What is the SMILES notation for N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine?
The canonical SMILES for N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine is CN(C)c1ccnc(-c2nc(Cl)c(Cl)c(Cl)n2)c1.
What is the InChIKey of N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine?
The InChIKey is AUAFZPLIMAQMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl3N4/c1-18(2)6-3-4-15-7(5-6)11-16-9(13)8(12)10(14)17-11/h3-5H,1-2H3.
What are the key properties of N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine?
N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine has a molecular weight of 303.58 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(4,5,6-trichloropyrimidin-2-yl)pyridin-4-amine is sourced from PubChem (CID 87337521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).