C18H12F3NO — CID 15022677
2-(2,4-difluorophenyl)-6-(3-fluorophenyl)-4-methoxypyridine (PubChem CID 15022677) has the molecular formula C18H12F3NO and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-6-(3-fluorophenyl)-4-methoxypyridine.
| Compound Name | 2-(2,4-difluorophenyl)-6-(3-fluorophenyl)-4-methoxypyridine |
|---|---|
| PubChem CID | 15022677 |
| Molecular Formula | C18H12F3NO |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-(2,4-difluorophenyl)-6-(3-fluorophenyl)-4-methoxypyridine |
| SMILES | COc1cc(-c2cccc(F)c2)nc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C18H12F3NO/c1-23-14-9-17(11-3-2-4-12(19)7-11)22-18(10-14)15-6-5-13(20)8-16(15)21/h2-10H,1H3 |
| InChIKey | AGDBLRZWMMICRN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |