C17H14FN3O — CID 75359921
4-(2-fluorophenyl)-6-(3-methoxyphenyl)pyrimidin-2-amine (PubChem CID 75359921) has the molecular formula C17H14FN3O and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-6-(3-methoxyphenyl)pyrimidin-2-amine.
| Compound Name | 4-(2-fluorophenyl)-6-(3-methoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 75359921 |
| Molecular Formula | C17H14FN3O |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-(2-fluorophenyl)-6-(3-methoxyphenyl)pyrimidin-2-amine |
| SMILES | COc1cccc(-c2cc(-c3ccccc3F)nc(N)n2)c1 |
| InChI | InChI=1S/C17H14FN3O/c1-22-12-6-4-5-11(9-12)15-10-16(21-17(19)20-15)13-7-2-3-8-14(13)18/h2-10H,1H3,(H2,19,20,21) |
| InChIKey | ZGJZNLANXNUVQB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |