C19H26FNO — CID 145210780
(3R)-2,3-dimethylpentane;2-(4-fluorophenyl)-4-methoxypyridine (PubChem CID 145210780) has the molecular formula C19H26FNO and a molecular weight of 303.42 g/mol. Its IUPAC name is (3R)-2,3-dimethylpentane;2-(4-fluorophenyl)-4-methoxypyridine.
| Compound Name | (3R)-2,3-dimethylpentane;2-(4-fluorophenyl)-4-methoxypyridine |
|---|---|
| PubChem CID | 145210780 |
| Molecular Formula | C19H26FNO |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (3R)-2,3-dimethylpentane;2-(4-fluorophenyl)-4-methoxypyridine |
| SMILES | CC[C@@H](C)C(C)C.COc1ccnc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C12H10FNO.C7H16/c1-15-11-6-7-14-12(8-11)9-2-4-10(13)5-3-9;1-5-7(4)6(2)3/h2-8H,1H3;6-7H,5H2,1-4H3/t;7-/m.1/s1 |
| InChIKey | SBNOGTHUDSWTOE-HMZWWLAASA-N |
| XLogP | 5.58 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |