About 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid
2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid (PubChem CID 58415864) has the molecular formula C20H15F2NO2
and a molecular weight of 339.34 g/mol. Its IUPAC name is 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid.
Molecular Properties
| Compound Name | 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid |
| PubChem CID | 58415864 |
| Molecular Formula | C20H15F2NO2 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid |
| SMILES | Cc1ccc(Cc2ccc(-c3ccc(F)cc3F)nc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H15F2NO2/c1-12-2-4-14(17(8-12)20(24)25)9-13-3-7-19(23-11-13)16-6-5-15(21)10-18(16)22/h2-8,10-11H,9H2,1H3,(H,24,25) |
| InChIKey | XUWHZQWFVHNDDN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid?
The IUPAC name of 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid (CID 58415864) is 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid.
What is the SMILES notation for 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid?
The canonical SMILES for 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid is Cc1ccc(Cc2ccc(-c3ccc(F)cc3F)nc2)c(C(=O)O)c1.
What is the InChIKey of 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid?
The InChIKey is XUWHZQWFVHNDDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2NO2/c1-12-2-4-14(17(8-12)20(24)25)9-13-3-7-19(23-11-13)16-6-5-15(21)10-18(16)22/h2-8,10-11H,9H2,1H3,(H,24,25).
What are the key properties of 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid?
2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid has a molecular weight of 339.34 g/mol, XLogP of 4.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-(2,4-difluorophenyl)-3-pyridinyl]methyl]-5-methylbenzoic acid is sourced from PubChem (CID 58415864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).