C15H14FNO2 — CID 79740577
2-[(5-ethyl-2-pyridinyl)methyl]-5-fluorobenzoic acid (PubChem CID 79740577) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-[(5-ethyl-2-pyridinyl)methyl]-5-fluorobenzoic acid.
| Compound Name | 2-[(5-ethyl-2-pyridinyl)methyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 79740577 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-[(5-ethyl-2-pyridinyl)methyl]-5-fluorobenzoic acid |
| SMILES | CCc1ccc(Cc2ccc(F)cc2C(=O)O)nc1 |
| InChI | InChI=1S/C15H14FNO2/c1-2-10-3-6-13(17-9-10)7-11-4-5-12(16)8-14(11)15(18)19/h3-6,8-9H,2,7H2,1H3,(H,18,19) |
| InChIKey | IMJXIAWDJYEMOU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |