C14H14FNO — CID 83129957
2-[(5-ethyl-2-pyridinyl)methyl]-5-fluorophenol (PubChem CID 83129957) has the molecular formula C14H14FNO and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-[(5-ethyl-2-pyridinyl)methyl]-5-fluorophenol.
| Compound Name | 2-[(5-ethyl-2-pyridinyl)methyl]-5-fluorophenol |
|---|---|
| PubChem CID | 83129957 |
| Molecular Formula | C14H14FNO |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-[(5-ethyl-2-pyridinyl)methyl]-5-fluorophenol |
| SMILES | CCc1ccc(Cc2ccc(F)cc2O)nc1 |
| InChI | InChI=1S/C14H14FNO/c1-2-10-3-6-13(16-9-10)7-11-4-5-12(15)8-14(11)17/h3-6,8-9,17H,2,7H2,1H3 |
| InChIKey | OYPOOXNHUWPWKN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |