C17H21FN4O — CID 50973078
2-[[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]methyl]-5-fluorophenol (PubChem CID 50973078) has the molecular formula C17H21FN4O and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]methyl]-5-fluorophenol.
| Compound Name | 2-[[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]methyl]-5-fluorophenol |
|---|---|
| PubChem CID | 50973078 |
| Molecular Formula | C17H21FN4O |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]methyl]-5-fluorophenol |
| SMILES | CCc1cnc(N2CCN(Cc3ccc(F)cc3O)CC2)nc1 |
| InChI | InChI=1S/C17H21FN4O/c1-2-13-10-19-17(20-11-13)22-7-5-21(6-8-22)12-14-3-4-15(18)9-16(14)23/h3-4,9-11,23H,2,5-8,12H2,1H3 |
| InChIKey | AQYXNSMDHAUFMG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|