C20H14F3NO2 — CID 58415794
5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]methyl]benzoic acid (PubChem CID 58415794) has the molecular formula C20H14F3NO2 and a molecular weight of 357.33 g/mol. Its IUPAC name is 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]methyl]benzoic acid.
| Compound Name | 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 58415794 |
| Molecular Formula | C20H14F3NO2 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]methyl]benzoic acid |
| SMILES | Cc1ccc(Cc2ccc(-c3c(F)ccc(F)c3F)nc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H14F3NO2/c1-11-2-4-13(14(8-11)20(25)26)9-12-3-7-17(24-10-12)18-15(21)5-6-16(22)19(18)23/h2-8,10H,9H2,1H3,(H,25,26) |
| InChIKey | LWRMEWKFOBUNJI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|