C18H10F5N — CID 134268745
2-[2-methyl-5-(2,3,4,5,6-pentafluorophenyl)phenyl]pyridine (PubChem CID 134268745) has the molecular formula C18H10F5N and a molecular weight of 335.28 g/mol. Its IUPAC name is 2-[2-methyl-5-(2,3,4,5,6-pentafluorophenyl)phenyl]pyridine.
| Compound Name | 2-[2-methyl-5-(2,3,4,5,6-pentafluorophenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 134268745 |
| Molecular Formula | C18H10F5N |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-[2-methyl-5-(2,3,4,5,6-pentafluorophenyl)phenyl]pyridine |
| SMILES | Cc1ccc(-c2c(F)c(F)c(F)c(F)c2F)cc1-c1ccccn1 |
| InChI | InChI=1S/C18H10F5N/c1-9-5-6-10(8-11(9)12-4-2-3-7-24-12)13-14(19)16(21)18(23)17(22)15(13)20/h2-8H,1H3 |
| InChIKey | IIYJOGNVXRALBT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|