C20H17N3O4 — CID 160598821
3-methyl-2H-isoquinolin-1-one;3-methyl-4-nitro-2H-isoquinolin-1-one (PubChem CID 160598821) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 3-methyl-2H-isoquinolin-1-one;3-methyl-4-nitro-2H-isoquinolin-1-one.
| Compound Name | 3-methyl-2H-isoquinolin-1-one;3-methyl-4-nitro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 160598821 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-methyl-2H-isoquinolin-1-one;3-methyl-4-nitro-2H-isoquinolin-1-one |
| SMILES | Cc1[nH]c(=O)c2ccccc2c1[N+](=O)[O-].Cc1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H8N2O3.C10H9NO/c1-6-9(12(14)15)7-4-2-3-5-8(7)10(13)11-6;1-7-6-8-4-2-3-5-9(8)10(12)11-7/h2-5H,1H3,(H,11,13);2-6H,1H3,(H,11,12) |
| InChIKey | RDZOTHCQFIIZGB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|