C13H10N2O2 — CID 171549932
4-methyl-3,5-dihydrobenzo[c][1,7]naphthyridine-2,6-dione (PubChem CID 171549932) has the molecular formula C13H10N2O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-methyl-3,5-dihydrobenzo[c][1,7]naphthyridine-2,6-dione.
| Compound Name | 4-methyl-3,5-dihydrobenzo[c][1,7]naphthyridine-2,6-dione |
|---|---|
| PubChem CID | 171549932 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 4-methyl-3,5-dihydrobenzo[c][1,7]naphthyridine-2,6-dione |
| SMILES | Cc1[nH]c(=O)cc2c1[nH]c(=O)c1ccccc12 |
| InChI | InChI=1S/C13H10N2O2/c1-7-12-10(6-11(16)14-7)8-4-2-3-5-9(8)13(17)15-12/h2-6H,1H3,(H,14,16)(H,15,17) |
| InChIKey | OATXQWLBNATKAZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|