C20H13N3O3 — CID 175518649
(E)-3-(4-nitrophenyl)-1-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-one (PubChem CID 175518649) has the molecular formula C20H13N3O3 and a molecular weight of 343.34 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-1-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-nitrophenyl)-1-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175518649 |
| Molecular Formula | C20H13N3O3 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-1-(9H-pyrido[3,4-b]indol-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C20H13N3O3/c24-18(10-7-13-5-8-14(9-6-13)23(25)26)20-19-16(11-12-21-20)15-3-1-2-4-17(15)22-19/h1-12,22H/b10-7+ |
| InChIKey | PKKLGRJULYGADP-JXMROGBWSA-N |
| XLogP | 4.52 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|