C30H25N3O5 — CID 168806088
1-[4-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]phenyl]-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 168806088) has the molecular formula C30H25N3O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is 1-[4-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]phenyl]-3-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-[4-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]phenyl]-3-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 168806088 |
| Molecular Formula | C30H25N3O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 1-[4-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]phenyl]-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])cc1)c1ccc(NCC(O)COc2cccc3[nH]c4ccccc4c23)cc1 |
| InChI | InChI=1S/C30H25N3O5/c34-24(19-38-29-7-3-6-27-30(29)25-4-1-2-5-26(25)32-27)18-31-22-13-11-21(12-14-22)28(35)17-10-20-8-15-23(16-9-20)33(36)37/h1-17,24,31-32,34H,18-19H2 |
| InChIKey | XIZRYIADDFMCHK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|