C11H11F2NO — CID 119054250
3,3-difluoro-5-propan-2-yl-1H-indol-2-one (PubChem CID 119054250) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 3,3-difluoro-5-propan-2-yl-1H-indol-2-one.
| Compound Name | 3,3-difluoro-5-propan-2-yl-1H-indol-2-one |
|---|---|
| PubChem CID | 119054250 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3,3-difluoro-5-propan-2-yl-1H-indol-2-one |
| SMILES | CC(C)c1ccc2c(c1)C(F)(F)C(=O)N2 |
| InChI | InChI=1S/C11H11F2NO/c1-6(2)7-3-4-9-8(5-7)11(12,13)10(15)14-9/h3-6H,1-2H3,(H,14,15) |
| InChIKey | CHADEBIZFPFMGG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |