C13H12F2O — CID 167331477
1,1-difluoro-7-propan-2-ylnaphthalen-2-one (PubChem CID 167331477) has the molecular formula C13H12F2O and a molecular weight of 222.23 g/mol. Its IUPAC name is 1,1-difluoro-7-propan-2-ylnaphthalen-2-one.
| Compound Name | 1,1-difluoro-7-propan-2-ylnaphthalen-2-one |
|---|---|
| PubChem CID | 167331477 |
| Molecular Formula | C13H12F2O |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1,1-difluoro-7-propan-2-ylnaphthalen-2-one |
| SMILES | CC(C)c1ccc2c(c1)C(F)(F)C(=O)C=C2 |
| InChI | InChI=1S/C13H12F2O/c1-8(2)10-4-3-9-5-6-12(16)13(14,15)11(9)7-10/h3-8H,1-2H3 |
| InChIKey | MHALWULYSAPOFM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |