C13H18N2O2 — CID 82496319
5-(2-amino-1-hydroxypropyl)-3,3-dimethyl-1H-indol-2-one (PubChem CID 82496319) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-(2-amino-1-hydroxypropyl)-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-(2-amino-1-hydroxypropyl)-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 82496319 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 5-(2-amino-1-hydroxypropyl)-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC(N)C(O)c1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C13H18N2O2/c1-7(14)11(16)8-4-5-10-9(6-8)13(2,3)12(17)15-10/h4-7,11,16H,14H2,1-3H3,(H,15,17) |
| InChIKey | ADEBCYCKPZOHAY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |