C18H19NO2 — CID 79015068
5-[hydroxy-(3-methylphenyl)methyl]-3,3-dimethyl-1H-indol-2-one (PubChem CID 79015068) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-[hydroxy-(3-methylphenyl)methyl]-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-[hydroxy-(3-methylphenyl)methyl]-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 79015068 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-[hydroxy-(3-methylphenyl)methyl]-3,3-dimethyl-1H-indol-2-one |
| SMILES | Cc1cccc(C(O)c2ccc3c(c2)C(C)(C)C(=O)N3)c1 |
| InChI | InChI=1S/C18H19NO2/c1-11-5-4-6-12(9-11)16(20)13-7-8-15-14(10-13)18(2,3)17(21)19-15/h4-10,16,20H,1-3H3,(H,19,21) |
| InChIKey | FPTJIADQMHBIRF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |