C15H20ClNO — CID 80501056
5-(1-chloro-2,2-dimethylpropyl)-3,3-dimethyl-1H-indol-2-one (PubChem CID 80501056) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is 5-(1-chloro-2,2-dimethylpropyl)-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-(1-chloro-2,2-dimethylpropyl)-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 80501056 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 5-(1-chloro-2,2-dimethylpropyl)-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2ccc(C(Cl)C(C)(C)C)cc21 |
| InChI | InChI=1S/C15H20ClNO/c1-14(2,3)12(16)9-6-7-11-10(8-9)15(4,5)13(18)17-11/h6-8,12H,1-5H3,(H,17,18) |
| InChIKey | WPWOUAYTJDVFGQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|