About 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one
5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one (PubChem CID 10684264) has the molecular formula C12H12BrNO2
and a molecular weight of 282.14 g/mol. Its IUPAC name is 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one.
Molecular Properties
| Compound Name | 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one |
| PubChem CID | 10684264 |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2ccc(C(=O)CBr)cc21 |
| InChI | InChI=1S/C12H12BrNO2/c1-12(2)8-5-7(10(15)6-13)3-4-9(8)14-11(12)16/h3-5H,6H2,1-2H3,(H,14,16) |
| InChIKey | WZENROBSOBOGPW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one?
The IUPAC name of 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one (CID 10684264) is 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one.
What is the SMILES notation for 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one?
The canonical SMILES for 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one is CC1(C)C(=O)Nc2ccc(C(=O)CBr)cc21.
What is the InChIKey of 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one?
The InChIKey is WZENROBSOBOGPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNO2/c1-12(2)8-5-7(10(15)6-13)3-4-9(8)14-11(12)16/h3-5H,6H2,1-2H3,(H,14,16).
What are the key properties of 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one?
5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one has a molecular weight of 282.14 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromoacetyl)-3,3-dimethyl-1H-indol-2-one is sourced from PubChem (CID 10684264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).