C15H20BrNO2 — CID 13084685
5-(5-bromopentoxy)-3,3-dimethyl-1H-indol-2-one (PubChem CID 13084685) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is 5-(5-bromopentoxy)-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-(5-bromopentoxy)-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 13084685 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-(5-bromopentoxy)-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2ccc(OCCCCCBr)cc21 |
| InChI | InChI=1S/C15H20BrNO2/c1-15(2)12-10-11(19-9-5-3-4-8-16)6-7-13(12)17-14(15)18/h6-7,10H,3-5,8-9H2,1-2H3,(H,17,18) |
| InChIKey | HZZTZNUTUOZIMO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|