C21H25NO2S — CID 13084679
5-(4-benzylsulfanylbutoxy)-3,3-dimethyl-1H-indol-2-one (PubChem CID 13084679) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is 5-(4-benzylsulfanylbutoxy)-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-(4-benzylsulfanylbutoxy)-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 13084679 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 5-(4-benzylsulfanylbutoxy)-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2ccc(OCCCCSCc3ccccc3)cc21 |
| InChI | InChI=1S/C21H25NO2S/c1-21(2)18-14-17(10-11-19(18)22-20(21)23)24-12-6-7-13-25-15-16-8-4-3-5-9-16/h3-5,8-11,14H,6-7,12-13,15H2,1-2H3,(H,22,23) |
| InChIKey | LYYMTEUQOZVXQF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|