C13H15NO3 — CID 10082710
3,3-dimethyl-5-(oxiran-2-ylmethoxy)-1H-indol-2-one (PubChem CID 10082710) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3,3-dimethyl-5-(oxiran-2-ylmethoxy)-1H-indol-2-one.
| Compound Name | 3,3-dimethyl-5-(oxiran-2-ylmethoxy)-1H-indol-2-one |
|---|---|
| PubChem CID | 10082710 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3,3-dimethyl-5-(oxiran-2-ylmethoxy)-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2ccc(OCC3CO3)cc21 |
| InChI | InChI=1S/C13H15NO3/c1-13(2)10-5-8(16-6-9-7-17-9)3-4-11(10)14-12(13)15/h3-5,9H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | LMOLSNFSFULVHX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|