C20H22FNO3S — CID 13084651
5-[4-(4-fluorophenyl)sulfinylbutoxy]-3,3-dimethyl-1H-indol-2-one (PubChem CID 13084651) has the molecular formula C20H22FNO3S and a molecular weight of 375.47 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)sulfinylbutoxy]-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-[4-(4-fluorophenyl)sulfinylbutoxy]-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 13084651 |
| Molecular Formula | C20H22FNO3S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 5-[4-(4-fluorophenyl)sulfinylbutoxy]-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2ccc(OCCCCS(=O)c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C20H22FNO3S/c1-20(2)17-13-15(7-10-18(17)22-19(20)23)25-11-3-4-12-26(24)16-8-5-14(21)6-9-16/h5-10,13H,3-4,11-12H2,1-2H3,(H,22,23) |
| InChIKey | YMHOUXAZZQADTJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|