C19H22N2O4S — CID 13260598
4,4-dimethyl-6-(4-pyridin-2-ylsulfinylbutoxy)-1H-3,1-benzoxazin-2-one (PubChem CID 13260598) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 4,4-dimethyl-6-(4-pyridin-2-ylsulfinylbutoxy)-1H-3,1-benzoxazin-2-one.
| Compound Name | 4,4-dimethyl-6-(4-pyridin-2-ylsulfinylbutoxy)-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 13260598 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4,4-dimethyl-6-(4-pyridin-2-ylsulfinylbutoxy)-1H-3,1-benzoxazin-2-one |
| SMILES | CC1(C)OC(=O)Nc2ccc(OCCCCS(=O)c3ccccn3)cc21 |
| InChI | InChI=1S/C19H22N2O4S/c1-19(2)15-13-14(8-9-16(15)21-18(22)25-19)24-11-5-6-12-26(23)17-7-3-4-10-20-17/h3-4,7-10,13H,5-6,11-12H2,1-2H3,(H,21,22) |
| InChIKey | ZBDWCDRWWUKMLU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|