C26H33N2O5S+ — CID 88690971
(2-acetyl-4-tert-butylphenyl)-[4-[(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)oxy]butylidene]-sulfanyloxyazanium (PubChem CID 88690971) has the molecular formula C26H33N2O5S+ and a molecular weight of 485.63 g/mol. Its IUPAC name is (2-acetyl-4-tert-butylphenyl)-[4-[(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)oxy]butylidene]-sulfanyloxyazanium.
| Compound Name | (2-acetyl-4-tert-butylphenyl)-[4-[(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)oxy]butylidene]-sulfanyloxyazanium |
|---|---|
| PubChem CID | 88690971 |
| Molecular Formula | C26H33N2O5S+ |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | (2-acetyl-4-tert-butylphenyl)-[4-[(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)oxy]butylidene]-sulfanyloxyazanium |
| SMILES | CC(=O)c1cc(C(C)(C)C)ccc1[N+](=CCCCOc1ccc2c(c1)C(C)(C)OC(=O)N2)OS |
| InChI | InChI=1S/C26H32N2O5S/c1-17(29)20-15-18(25(2,3)4)9-12-23(20)28(33-34)13-7-8-14-31-19-10-11-22-21(16-19)26(5,6)32-24(30)27-22/h9-13,15-16H,7-8,14H2,1-6H3,(H-,27,30,34)/p+1 |
| InChIKey | WNFXCJBFBPJQMT-UHFFFAOYSA-O |
| XLogP | 6.33 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|