C20H20Cl2N2O4S — CID 88690884
7-[4-(3,4-dichlorophenyl)sulfanyloxyiminobutoxy]-4,4-dimethyl-1H-3,1-benzoxazin-2-one (PubChem CID 88690884) has the molecular formula C20H20Cl2N2O4S and a molecular weight of 455.36 g/mol. Its IUPAC name is 7-[4-(3,4-dichlorophenyl)sulfanyloxyiminobutoxy]-4,4-dimethyl-1H-3,1-benzoxazin-2-one.
| Compound Name | 7-[4-(3,4-dichlorophenyl)sulfanyloxyiminobutoxy]-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 88690884 |
| Molecular Formula | C20H20Cl2N2O4S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 7-[4-(3,4-dichlorophenyl)sulfanyloxyiminobutoxy]-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| SMILES | CC1(C)OC(=O)Nc2cc(OCCCC=NOSc3ccc(Cl)c(Cl)c3)ccc21 |
| InChI | InChI=1S/C20H20Cl2N2O4S/c1-20(2)15-7-5-13(11-18(15)24-19(25)27-20)26-10-4-3-9-23-28-29-14-6-8-16(21)17(22)12-14/h5-9,11-12H,3-4,10H2,1-2H3,(H,24,25) |
| InChIKey | AZXNEAZLMKJAEQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|