C26H32N2O6S — CID 88692521
5-[4-(2-butanoyl-3,4-dimethoxyphenyl)sulfanyloxyiminobutoxy]-3,3-dimethyl-1H-indol-2-one (PubChem CID 88692521) has the molecular formula C26H32N2O6S and a molecular weight of 500.62 g/mol. Its IUPAC name is 5-[4-(2-butanoyl-3,4-dimethoxyphenyl)sulfanyloxyiminobutoxy]-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-[4-(2-butanoyl-3,4-dimethoxyphenyl)sulfanyloxyiminobutoxy]-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 88692521 |
| Molecular Formula | C26H32N2O6S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 5-[4-(2-butanoyl-3,4-dimethoxyphenyl)sulfanyloxyiminobutoxy]-3,3-dimethyl-1H-indol-2-one |
| SMILES | CCCC(=O)c1c(SON=CCCCOc2ccc3c(c2)C(C)(C)C(=O)N3)ccc(OC)c1OC |
| InChI | InChI=1S/C26H32N2O6S/c1-6-9-20(29)23-22(13-12-21(31-4)24(23)32-5)35-34-27-14-7-8-15-33-17-10-11-19-18(16-17)26(2,3)25(30)28-19/h10-14,16H,6-9,15H2,1-5H3,(H,28,30) |
| InChIKey | GZTVAIPKXPYHTK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|