C21H24N2O4S — CID 88706414
6-[4-(3,4-dimethoxyphenyl)sulfanyliminobutoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 88706414) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 6-[4-(3,4-dimethoxyphenyl)sulfanyliminobutoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-(3,4-dimethoxyphenyl)sulfanyliminobutoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 88706414 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 6-[4-(3,4-dimethoxyphenyl)sulfanyliminobutoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1ccc(SN=CCCCOc2ccc3c(c2)CCC(=O)N3)cc1OC |
| InChI | InChI=1S/C21H24N2O4S/c1-25-19-9-7-17(14-20(19)26-2)28-22-11-3-4-12-27-16-6-8-18-15(13-16)5-10-21(24)23-18/h6-9,11,13-14H,3-5,10,12H2,1-2H3,(H,23,24) |
| InChIKey | PHVHZQJCRVMYGV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|