C22H27NO4S — CID 13084618
5-[4-(3,4-dimethoxyphenyl)sulfanylbutoxy]-3,3-dimethyl-1H-indol-2-one (PubChem CID 13084618) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is 5-[4-(3,4-dimethoxyphenyl)sulfanylbutoxy]-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-[4-(3,4-dimethoxyphenyl)sulfanylbutoxy]-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 13084618 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 5-[4-(3,4-dimethoxyphenyl)sulfanylbutoxy]-3,3-dimethyl-1H-indol-2-one |
| SMILES | COc1ccc(SCCCCOc2ccc3c(c2)C(C)(C)C(=O)N3)cc1OC |
| InChI | InChI=1S/C22H27NO4S/c1-22(2)17-13-15(7-9-18(17)23-21(22)24)27-11-5-6-12-28-16-8-10-19(25-3)20(14-16)26-4/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,23,24) |
| InChIKey | SFIADJZXMKJVRB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|