C18H19NO2 — CID 155513113
3,3-dimethyl-5-(2-phenylethoxy)-1H-indol-2-one (PubChem CID 155513113) has the molecular formula C18H19NO2 and a molecular weight of 281.35 g/mol. Its IUPAC name is 3,3-dimethyl-5-(2-phenylethoxy)-1H-indol-2-one.
| Compound Name | 3,3-dimethyl-5-(2-phenylethoxy)-1H-indol-2-one |
|---|---|
| PubChem CID | 155513113 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3,3-dimethyl-5-(2-phenylethoxy)-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2ccc(OCCc3ccccc3)cc21 |
| InChI | InChI=1S/C18H19NO2/c1-18(2)15-12-14(8-9-16(15)19-17(18)20)21-11-10-13-6-4-3-5-7-13/h3-9,12H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | ACUHWZASTCSIET-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |