C15H11NO3 — CID 16792980
5-phenylmethoxy-1H-indole-2,3-dione (PubChem CID 16792980) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 5-phenylmethoxy-1H-indole-2,3-dione.
| Compound Name | 5-phenylmethoxy-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 16792980 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 5-phenylmethoxy-1H-indole-2,3-dione |
| SMILES | O=C1Nc2ccc(OCc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C15H11NO3/c17-14-12-8-11(6-7-13(12)16-15(14)18)19-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17,18) |
| InChIKey | XLEOHANMYAZMTK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|