C17H12F3NO4 — CID 42633508
1-[(4-methoxyphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione (PubChem CID 42633508) has the molecular formula C17H12F3NO4 and a molecular weight of 351.28 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione |
|---|---|
| PubChem CID | 42633508 |
| Molecular Formula | C17H12F3NO4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione |
| SMILES | COc1ccc(CN2C(=O)C(=O)c3cc(OC(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C17H12F3NO4/c1-24-11-4-2-10(3-5-11)9-21-14-7-6-12(25-17(18,19)20)8-13(14)15(22)16(21)23/h2-8H,9H2,1H3 |
| InChIKey | CKLGZXFOLMHCMC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|