C18H17F2NO2 — CID 155294461
1-[[2-(difluoromethoxy)phenyl]methyl]-2,2-dimethylindol-3-one (PubChem CID 155294461) has the molecular formula C18H17F2NO2 and a molecular weight of 317.33 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-2,2-dimethylindol-3-one.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2,2-dimethylindol-3-one |
|---|---|
| PubChem CID | 155294461 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2,2-dimethylindol-3-one |
| SMILES | CC1(C)C(=O)c2ccccc2N1Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H17F2NO2/c1-18(2)16(22)13-8-4-5-9-14(13)21(18)11-12-7-3-6-10-15(12)23-17(19)20/h3-10,17H,11H2,1-2H3 |
| InChIKey | BSVSFPVFEQPRJW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |