C9H4F3NO3 — CID 2732752
5-(trifluoromethoxy)-1H-indole-2,3-dione (PubChem CID 2732752) has the molecular formula C9H4F3NO3 and a molecular weight of 231.13 g/mol. Its IUPAC name is 5-(trifluoromethoxy)-1H-indole-2,3-dione.
| Compound Name | 5-(trifluoromethoxy)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 2732752 |
| Molecular Formula | C9H4F3NO3 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 5-(trifluoromethoxy)-1H-indole-2,3-dione |
| SMILES | O=C1Nc2ccc(OC(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C9H4F3NO3/c10-9(11,12)16-4-1-2-6-5(3-4)7(14)8(15)13-6/h1-3H,(H,13,14,15) |
| InChIKey | XHAJMVPMNOBILF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|