C20H23NO3S — CID 20540046
6-[4-(2-methoxyphenyl)sulfanylbutoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 20540046) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is 6-[4-(2-methoxyphenyl)sulfanylbutoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-(2-methoxyphenyl)sulfanylbutoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 20540046 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 6-[4-(2-methoxyphenyl)sulfanylbutoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1ccccc1SCCCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C20H23NO3S/c1-23-18-6-2-3-7-19(18)25-13-5-4-12-24-16-9-10-17-15(14-16)8-11-20(22)21-17/h2-3,6-7,9-10,14H,4-5,8,11-13H2,1H3,(H,21,22) |
| InChIKey | KUSFMPGWDAZCQY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|