C19H18Cl3NO2S — CID 20539979
6-[4-(2,4,5-trichlorophenyl)sulfanylbutoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 20539979) has the molecular formula C19H18Cl3NO2S and a molecular weight of 430.78 g/mol. Its IUPAC name is 6-[4-(2,4,5-trichlorophenyl)sulfanylbutoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-(2,4,5-trichlorophenyl)sulfanylbutoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 20539979 |
| Molecular Formula | C19H18Cl3NO2S |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 6-[4-(2,4,5-trichlorophenyl)sulfanylbutoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(OCCCCSc3cc(Cl)c(Cl)cc3Cl)ccc2N1 |
| InChI | InChI=1S/C19H18Cl3NO2S/c20-14-10-16(22)18(11-15(14)21)26-8-2-1-7-25-13-4-5-17-12(9-13)3-6-19(24)23-17/h4-5,9-11H,1-3,6-8H2,(H,23,24) |
| InChIKey | NEWDMALZFFQYSA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|