C27H36N2O4S — CID 88692836
6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyloxyiminobutoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 88692836) has the molecular formula C27H36N2O4S and a molecular weight of 484.66 g/mol. Its IUPAC name is 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyloxyiminobutoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyloxyiminobutoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 88692836 |
| Molecular Formula | C27H36N2O4S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 6-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyloxyiminobutoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC(C)(C)c1cc(SON=CCCCOc2ccc3c(c2)CCC(=O)N3)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H36N2O4S/c1-26(2,3)21-16-20(17-22(25(21)31)27(4,5)6)34-33-28-13-7-8-14-32-19-10-11-23-18(15-19)9-12-24(30)29-23/h10-11,13,15-17,31H,7-9,12,14H2,1-6H3,(H,29,30) |
| InChIKey | RNOCGZFZMIKLDL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|