C23H29NO4S — CID 70558157
6-[4-(4-tert-butylphenyl)sulfonylbutoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 70558157) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is 6-[4-(4-tert-butylphenyl)sulfonylbutoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-(4-tert-butylphenyl)sulfonylbutoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 70558157 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 6-[4-(4-tert-butylphenyl)sulfonylbutoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)CCCCOc2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C23H29NO4S/c1-23(2,3)18-7-10-20(11-8-18)29(26,27)15-5-4-14-28-19-9-12-21-17(16-19)6-13-22(25)24-21/h7-12,16H,4-6,13-15H2,1-3H3,(H,24,25) |
| InChIKey | PQUWGOOWLZKATB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|