C28H29N2O6S+ — CID 88693329
(2-benzoyl-3,4-dimethoxyphenyl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanyloxyazanium (PubChem CID 88693329) has the molecular formula C28H29N2O6S+ and a molecular weight of 521.62 g/mol. Its IUPAC name is (2-benzoyl-3,4-dimethoxyphenyl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanyloxyazanium.
| Compound Name | (2-benzoyl-3,4-dimethoxyphenyl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanyloxyazanium |
|---|---|
| PubChem CID | 88693329 |
| Molecular Formula | C28H29N2O6S+ |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | (2-benzoyl-3,4-dimethoxyphenyl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanyloxyazanium |
| SMILES | COc1ccc([N+](=CCCCOc2ccc3c(c2)CCC(=O)N3)OS)c(C(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C28H28N2O6S/c1-33-24-14-13-23(26(28(24)34-2)27(32)19-8-4-3-5-9-19)30(36-37)16-6-7-17-35-21-11-12-22-20(18-21)10-15-25(31)29-22/h3-5,8-9,11-14,16,18H,6-7,10,15,17H2,1-2H3,(H-,29,31,37)/p+1 |
| InChIKey | PXNUOSRDQJPZTJ-UHFFFAOYSA-O |
| XLogP | 5.17 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|