C26H27Cl2N2O5S2+ — CID 88692704
(4-benzylsulfonyl-4,5-dichlorocyclohexa-1,5-dien-1-yl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanyloxyazanium (PubChem CID 88692704) has the molecular formula C26H27Cl2N2O5S2+ and a molecular weight of 582.55 g/mol. Its IUPAC name is (4-benzylsulfonyl-4,5-dichlorocyclohexa-1,5-dien-1-yl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanyloxyazanium.
| Compound Name | (4-benzylsulfonyl-4,5-dichlorocyclohexa-1,5-dien-1-yl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanyloxyazanium |
|---|---|
| PubChem CID | 88692704 |
| Molecular Formula | C26H27Cl2N2O5S2+ |
| Molecular Weight | 582.55 g/mol |
| Exact Mass | 581.07 |
| IUPAC Name | (4-benzylsulfonyl-4,5-dichlorocyclohexa-1,5-dien-1-yl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanyloxyazanium |
| SMILES | O=C1CCc2cc(OCCCC=[N+](OS)C3=CCC(Cl)(S(=O)(=O)Cc4ccccc4)C(Cl)=C3)ccc2N1 |
| InChI | InChI=1S/C26H26Cl2N2O5S2/c27-24-17-21(12-13-26(24,28)37(32,33)18-19-6-2-1-3-7-19)30(35-36)14-4-5-15-34-22-9-10-23-20(16-22)8-11-25(31)29-23/h1-3,6-7,9-10,12,14,16-17H,4-5,8,11,13,15,18H2,(H-,29,31,36)/p+1 |
| InChIKey | JLKDKZPFVKHKGI-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|