C26H27N2O4S2+ — CID 88693052
(4-benzylsulfonylphenyl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanylazanium (PubChem CID 88693052) has the molecular formula C26H27N2O4S2+ and a molecular weight of 495.65 g/mol. Its IUPAC name is (4-benzylsulfonylphenyl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanylazanium.
| Compound Name | (4-benzylsulfonylphenyl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanylazanium |
|---|---|
| PubChem CID | 88693052 |
| Molecular Formula | C26H27N2O4S2+ |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (4-benzylsulfonylphenyl)-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butylidene]-sulfanylazanium |
| SMILES | O=C1CCc2cc(OCCCC=[N+](S)c3ccc(S(=O)(=O)Cc4ccccc4)cc3)ccc2N1 |
| InChI | InChI=1S/C26H26N2O4S2/c29-26-15-8-21-18-23(11-14-25(21)27-26)32-17-5-4-16-28(33)22-9-12-24(13-10-22)34(30,31)19-20-6-2-1-3-7-20/h1-3,6-7,9-14,16,18H,4-5,8,15,17,19H2,(H-,27,29,33)/p+1 |
| InChIKey | WDATUVNPRJTHFN-UHFFFAOYSA-O |
| XLogP | 4.96 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|