C20H21Cl2NO3S — CID 13084631
5-[4-(3,5-dichloro-4-hydroxyphenyl)sulfanylbutoxy]-3,3-dimethyl-1H-indol-2-one (PubChem CID 13084631) has the molecular formula C20H21Cl2NO3S and a molecular weight of 426.37 g/mol. Its IUPAC name is 5-[4-(3,5-dichloro-4-hydroxyphenyl)sulfanylbutoxy]-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-[4-(3,5-dichloro-4-hydroxyphenyl)sulfanylbutoxy]-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 13084631 |
| Molecular Formula | C20H21Cl2NO3S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 5-[4-(3,5-dichloro-4-hydroxyphenyl)sulfanylbutoxy]-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2ccc(OCCCCSc3cc(Cl)c(O)c(Cl)c3)cc21 |
| InChI | InChI=1S/C20H21Cl2NO3S/c1-20(2)14-9-12(5-6-17(14)23-19(20)25)26-7-3-4-8-27-13-10-15(21)18(24)16(22)11-13/h5-6,9-11,24H,3-4,7-8H2,1-2H3,(H,23,25) |
| InChIKey | CUQPHLNMXBFDMY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|