C21H25NO3S — CID 13260531
6-(4-benzylsulfanylbutoxy)-4,4-dimethyl-1H-3,1-benzoxazin-2-one (PubChem CID 13260531) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 6-(4-benzylsulfanylbutoxy)-4,4-dimethyl-1H-3,1-benzoxazin-2-one.
| Compound Name | 6-(4-benzylsulfanylbutoxy)-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 13260531 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 6-(4-benzylsulfanylbutoxy)-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| SMILES | CC1(C)OC(=O)Nc2ccc(OCCCCSCc3ccccc3)cc21 |
| InChI | InChI=1S/C21H25NO3S/c1-21(2)18-14-17(10-11-19(18)22-20(23)25-21)24-12-6-7-13-26-15-16-8-4-3-5-9-16/h3-5,8-11,14H,6-7,12-13,15H2,1-2H3,(H,22,23) |
| InChIKey | NVEUCMFIYRICSJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|