C32H46N2O5S — CID 13260587
N-[4-[4-[(4,4-dihexyl-2-oxo-1H-3,1-benzoxazin-6-yl)oxy]butylsulfinyl]phenyl]acetamide (PubChem CID 13260587) has the molecular formula C32H46N2O5S and a molecular weight of 570.80 g/mol. Its IUPAC name is N-[4-[4-[(4,4-dihexyl-2-oxo-1H-3,1-benzoxazin-6-yl)oxy]butylsulfinyl]phenyl]acetamide.
| Compound Name | N-[4-[4-[(4,4-dihexyl-2-oxo-1H-3,1-benzoxazin-6-yl)oxy]butylsulfinyl]phenyl]acetamide |
|---|---|
| PubChem CID | 13260587 |
| Molecular Formula | C32H46N2O5S |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | N-[4-[4-[(4,4-dihexyl-2-oxo-1H-3,1-benzoxazin-6-yl)oxy]butylsulfinyl]phenyl]acetamide |
| SMILES | CCCCCCC1(CCCCCC)OC(=O)Nc2ccc(OCCCCS(=O)c3ccc(NC(C)=O)cc3)cc21 |
| InChI | InChI=1S/C32H46N2O5S/c1-4-6-8-10-20-32(21-11-9-7-5-2)29-24-27(16-19-30(29)34-31(36)39-32)38-22-12-13-23-40(37)28-17-14-26(15-18-28)33-25(3)35/h14-19,24H,4-13,20-23H2,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | LDCWFJIYIZOMRL-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|