C20H22N2O5S — CID 13260572
N-[4-[4-[(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)oxy]butylsulfinyl]phenyl]acetamide (PubChem CID 13260572) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[4-[4-[(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)oxy]butylsulfinyl]phenyl]acetamide.
| Compound Name | N-[4-[4-[(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)oxy]butylsulfinyl]phenyl]acetamide |
|---|---|
| PubChem CID | 13260572 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[4-[4-[(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)oxy]butylsulfinyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)CCCCOc2ccc3c(c2)COC(=O)N3)cc1 |
| InChI | InChI=1S/C20H22N2O5S/c1-14(23)21-16-4-7-18(8-5-16)28(25)11-3-2-10-26-17-6-9-19-15(12-17)13-27-20(24)22-19/h4-9,12H,2-3,10-11,13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | FAFCOPYECATMDM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|