C27H32O4 — CID 14344432
2-[[1,1,1',1'-tetramethyl-5'-(oxiran-2-ylmethoxy)-3,3'-spirobi[2H-indene]-5-yl]oxymethyl]oxirane (PubChem CID 14344432) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[[1,1,1',1'-tetramethyl-5'-(oxiran-2-ylmethoxy)-3,3'-spirobi[2H-indene]-5-yl]oxymethyl]oxirane.
| Compound Name | 2-[[1,1,1',1'-tetramethyl-5'-(oxiran-2-ylmethoxy)-3,3'-spirobi[2H-indene]-5-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 14344432 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-[[1,1,1',1'-tetramethyl-5'-(oxiran-2-ylmethoxy)-3,3'-spirobi[2H-indene]-5-yl]oxymethyl]oxirane |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(OCC4CO4)cc32)c2cc(OCC3CO3)ccc21 |
| InChI | InChI=1S/C27H32O4/c1-25(2)15-27(23-9-17(5-7-21(23)25)28-11-19-13-30-19)16-26(3,4)22-8-6-18(10-24(22)27)29-12-20-14-31-20/h5-10,19-20H,11-16H2,1-4H3 |
| InChIKey | OWNWZOSKIJZXKF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|