C19H15N3O4S — CID 66578741
ethyl 8-nitro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxylate (PubChem CID 66578741) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is ethyl 8-nitro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxylate.
| Compound Name | ethyl 8-nitro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 66578741 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | ethyl 8-nitro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)c2c1CSc1ccc([N+](=O)[O-])cc1-2 |
| InChI | InChI=1S/C19H15N3O4S/c1-2-26-19(23)17-15-11-27-16-9-8-13(22(24)25)10-14(16)18(15)21(20-17)12-6-4-3-5-7-12/h3-10H,2,11H2,1H3 |
| InChIKey | IJOJWBFFPHPUNP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|