C13H10N2O3S — CID 57412371
methyl 6-oxo-1-phenyl-4H-thieno[3,4-d]pyrazole-3-carboxylate (PubChem CID 57412371) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is methyl 6-oxo-1-phenyl-4H-thieno[3,4-d]pyrazole-3-carboxylate.
| Compound Name | methyl 6-oxo-1-phenyl-4H-thieno[3,4-d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 57412371 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | methyl 6-oxo-1-phenyl-4H-thieno[3,4-d]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2ccccc2)c2c1CSC2=O |
| InChI | InChI=1S/C13H10N2O3S/c1-18-12(16)10-9-7-19-13(17)11(9)15(14-10)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | VHBCCNVGTAOZJV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|