C17H18N4O4 — CID 95327366
methyl 5-[[(2S)-5-oxopyrrolidin-2-yl]methylcarbamoyl]-1-phenylpyrazole-3-carboxylate (PubChem CID 95327366) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is methyl 5-[[(2S)-5-oxopyrrolidin-2-yl]methylcarbamoyl]-1-phenylpyrazole-3-carboxylate.
| Compound Name | methyl 5-[[(2S)-5-oxopyrrolidin-2-yl]methylcarbamoyl]-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 95327366 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | methyl 5-[[(2S)-5-oxopyrrolidin-2-yl]methylcarbamoyl]-1-phenylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)NC[C@@H]2CCC(=O)N2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H18N4O4/c1-25-17(24)13-9-14(21(20-13)12-5-3-2-4-6-12)16(23)18-10-11-7-8-15(22)19-11/h2-6,9,11H,7-8,10H2,1H3,(H,18,23)(H,19,22)/t11-/m0/s1 |
| InChIKey | JCZCCKJKVOPPJG-NSHDSACASA-N |
| XLogP | 0.67 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |